C33H48O5 — CID 118646126
2-(2-hexoxyphenyl)propanoic acid;(8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 118646126) has the molecular formula C33H48O5 and a molecular weight of 524.74 g/mol. Its IUPAC name is 2-(2-hexoxyphenyl)propanoic acid;(8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 2-(2-hexoxyphenyl)propanoic acid;(8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118646126 |
| Molecular Formula | C33H48O5 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | 2-(2-hexoxyphenyl)propanoic acid;(8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCCOc1ccccc1C(C)C(=O)O.C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C18H26O2.C15H22O3/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;1-3-4-5-8-11-18-14-10-7-6-9-13(14)12(2)15(16)17/h10,13-17,20H,2-9H2,1H3;6-7,9-10,12H,3-5,8,11H2,1-2H3,(H,16,17)/t13-,14+,15+,16-,17-,18-;/m0./s1 |
| InChIKey | ZXQPNXQOBCWATR-OGVPJBRJSA-N |
| XLogP | 7.32 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|