C34H48O4 — CID 170337803
hexyl 3-[(8R,9S,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-3-phenylpropanoate (PubChem CID 170337803) has the molecular formula C34H48O4 and a molecular weight of 520.75 g/mol. Its IUPAC name is hexyl 3-[(8R,9S,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-3-phenylpropanoate.
| Compound Name | hexyl 3-[(8R,9S,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 170337803 |
| Molecular Formula | C34H48O4 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | hexyl 3-[(8R,9S,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-3-phenylpropanoate |
| SMILES | CCCCCCOC(=O)CC(c1ccccc1)C1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@H](O)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C34H48O4/c1-4-5-6-10-19-38-32(37)22-27(23-11-8-7-9-12-23)30-21-25(35)20-24-13-14-26-28-15-16-31(36)33(28,2)18-17-29(26)34(24,30)3/h7-9,11-12,20,26-31,36H,4-6,10,13-19,21-22H2,1-3H3/t26-,27?,28-,29-,30?,31-,33-,34-/m0/s1 |
| InChIKey | FWARBRVTOXUPLS-MXKVSCNRSA-N |
| XLogP | 7.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|