C23H32ClFO2 — CID 68871365
(7R,8S,9S,10R,11S,13S,14S)-7-(5-chloropentyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 68871365) has the molecular formula C23H32ClFO2 and a molecular weight of 394.96 g/mol. Its IUPAC name is (7R,8S,9S,10R,11S,13S,14S)-7-(5-chloropentyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7R,8S,9S,10R,11S,13S,14S)-7-(5-chloropentyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 68871365 |
| Molecular Formula | C23H32ClFO2 |
| Molecular Weight | 394.96 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (7R,8S,9S,10R,11S,13S,14S)-7-(5-chloropentyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@H](F)[C@H]3[C@@H]([C@H](CCCCCCl)CC4=CC(=O)CC[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C23H32ClFO2/c1-23-13-19(25)22-17-7-6-16(26)12-15(17)11-14(5-3-2-4-10-24)21(22)18(23)8-9-20(23)27/h12,14,17-19,21-22H,2-11,13H2,1H3/t14-,17+,18+,19+,21+,22+,23+/m1/s1 |
| InChIKey | QKQBMRSKEDDRHA-UXPCPDBYSA-N |
| XLogP | 5.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|