C23H34ClFO2 — CID 143816385
1-chloropentane;11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 143816385) has the molecular formula C23H34ClFO2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 1-chloropentane;11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 1-chloropentane;11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 143816385 |
| Molecular Formula | C23H34ClFO2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-chloropentane;11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC12CC(F)C3C4CCC(=O)C=C4CCC3C1CCC2=O.CCCCCCl |
| InChI | InChI=1S/C18H23FO2.C5H11Cl/c1-18-9-15(19)17-12-5-3-11(20)8-10(12)2-4-13(17)14(18)6-7-16(18)21;1-2-3-4-5-6/h8,12-15,17H,2-7,9H2,1H3;2-5H2,1H3 |
| InChIKey | ADDOCFZFCTYFLQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|