C19H25FO — CID 58105903
(11S,13S)-11-fluoro-3,13-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 58105903) has the molecular formula C19H25FO and a molecular weight of 288.41 g/mol. Its IUPAC name is (11S,13S)-11-fluoro-3,13-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (11S,13S)-11-fluoro-3,13-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 58105903 |
| Molecular Formula | C19H25FO |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (11S,13S)-11-fluoro-3,13-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC1=CC2=CCC3C(C(F)C[C@]4(C)C(=O)CCC34)C2CC1 |
| InChI | InChI=1S/C19H25FO/c1-11-3-5-13-12(9-11)4-6-14-15-7-8-17(21)19(15,2)10-16(20)18(13)14/h4,9,13-16,18H,3,5-8,10H2,1-2H3/t13?,14?,15?,16?,18?,19-/m0/s1 |
| InChIKey | JWAZUONEOAFBNV-FHXYWRNYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |