C19H25ClO2 — CID 57222204
(8R,9S,10R,11S,13S,14S)-11-(chloromethyl)-13-methyl-1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57222204) has the molecular formula C19H25ClO2 and a molecular weight of 320.86 g/mol. Its IUPAC name is (8R,9S,10R,11S,13S,14S)-11-(chloromethyl)-13-methyl-1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,11S,13S,14S)-11-(chloromethyl)-13-methyl-1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57222204 |
| Molecular Formula | C19H25ClO2 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (8R,9S,10R,11S,13S,14S)-11-(chloromethyl)-13-methyl-1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@H](CCl)[C@H]3[C@@H](CC=C4CC(=O)CC[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H25ClO2/c1-19-9-12(10-20)18-14-5-3-13(21)8-11(14)2-4-15(18)16(19)6-7-17(19)22/h2,12,14-16,18H,3-10H2,1H3/t12-,14+,15+,16+,18-,19+/m1/s1 |
| InChIKey | CCXVPPVEWOXEAJ-FPCVLZJASA-N |
| XLogP | 4.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|