C19H24O3 — CID 56990859
(8S,9S,10R,13S,14S)-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione (PubChem CID 56990859) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione.
| Compound Name | (8S,9S,10R,13S,14S)-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione |
|---|---|
| PubChem CID | 56990859 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (8S,9S,10R,13S,14S)-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione |
| SMILES | CC[C@]12CC(=O)[C@H]3[C@@H](CC=C4CC(=O)CC[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H24O3/c1-2-19-10-16(21)18-13-6-4-12(20)9-11(13)3-5-14(18)15(19)7-8-17(19)22/h3,13-15,18H,2,4-10H2,1H3/t13-,14-,15-,18+,19-/m0/s1 |
| InChIKey | IAXFAOPKAMFSOB-QERJWTBHSA-N |
| XLogP | 3.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|