C21H28O2S2 — CID 166716221
(8'R,10'S,13'S)-13'-ethylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11',17'-dione (PubChem CID 166716221) has the molecular formula C21H28O2S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is (8'R,10'S,13'S)-13'-ethylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11',17'-dione.
| Compound Name | (8'R,10'S,13'S)-13'-ethylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11',17'-dione |
|---|---|
| PubChem CID | 166716221 |
| Molecular Formula | C21H28O2S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (8'R,10'S,13'S)-13'-ethylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11',17'-dione |
| SMILES | CC[C@]12CC(=O)C3[C@H](CCC4=CC5(CC[C@H]43)SCCS5)C1CCC2=O |
| InChI | InChI=1S/C21H28O2S2/c1-2-20-12-17(22)19-14-7-8-21(24-9-10-25-21)11-13(14)3-4-15(19)16(20)5-6-18(20)23/h11,14-16,19H,2-10,12H2,1H3/t14-,15-,16?,19?,20+/m1/s1 |
| InChIKey | UCKULVHZMVTOCW-SUSJGWANSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|