C19H28N2O4 — CID 163818076
(13S)-3,3-diaminooxy-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-11,17-dione (PubChem CID 163818076) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (13S)-3,3-diaminooxy-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-11,17-dione.
| Compound Name | (13S)-3,3-diaminooxy-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-11,17-dione |
|---|---|
| PubChem CID | 163818076 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (13S)-3,3-diaminooxy-13-ethyl-2,4,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-11,17-dione |
| SMILES | CC[C@]12CC(=O)C3C4CCC(ON)(ON)CC4=CCC3C1CCC2=O |
| InChI | InChI=1S/C19H28N2O4/c1-2-18-10-15(22)17-12-7-8-19(24-20,25-21)9-11(12)3-4-13(17)14(18)5-6-16(18)23/h3,12-14,17H,2,4-10,20-21H2,1H3/t12?,13?,14?,17?,18-/m0/s1 |
| InChIKey | NTAMAUFJRFYIMY-NHTVISPTSA-N |
| XLogP | 2.17 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|