C28H46O4Si — CID 91502167
(2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one (PubChem CID 91502167) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one.
| Compound Name | (2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one |
|---|---|
| PubChem CID | 91502167 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one |
| SMILES | CC1(C)OC2=C3CC(=O)CC[C@]3(C)C3CC[C@@]4(C)C(CC[C@@H]4O[Si](C)(C)C(C)(C)C)C3[C@H]2O1 |
| InChI | InChI=1S/C28H46O4Si/c1-25(2,3)33(8,9)32-21-11-10-18-22-19(13-15-28(18,21)7)27(6)14-12-17(29)16-20(27)23-24(22)31-26(4,5)30-23/h18-19,21-22,24H,10-16H2,1-9H3/t18?,19?,21-,22?,24+,27+,28-/m0/s1 |
| InChIKey | FXVIUXJAHWFVFG-YZKNSWKASA-N |
| XLogP | 7.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|