C35H66O5Si2 — CID 54266103
(12R,16S)-9,17-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,11,12,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-11-ol (PubChem CID 54266103) has the molecular formula C35H66O5Si2 and a molecular weight of 623.08 g/mol. Its IUPAC name is (12R,16S)-9,17-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,11,12,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-11-ol.
| Compound Name | (12R,16S)-9,17-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,11,12,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-11-ol |
|---|---|
| PubChem CID | 54266103 |
| Molecular Formula | C35H66O5Si2 |
| Molecular Weight | 623.08 g/mol |
| Exact Mass | 622.44 |
| IUPAC Name | (12R,16S)-9,17-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,11,12,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-11-ol |
| SMILES | CC1(C)OC2C(O1)C1CC(O[Si](C)(C)C(C)(C)C)CC(C)(O)[C@]1(C)C1CC[C@]3(C)C(O[Si](C)(C)C(C)(C)C)CCC3C21 |
| InChI | InChI=1S/C35H66O5Si2/c1-30(2,3)41(12,13)39-22-20-25-28-29(38-32(7,8)37-28)27-23-16-17-26(40-42(14,15)31(4,5)6)33(23,9)19-18-24(27)35(25,11)34(10,36)21-22/h22-29,36H,16-21H2,1-15H3/t22?,23?,24?,25?,26?,27?,28?,29?,33-,34?,35+/m0/s1 |
| InChIKey | RGWSJQXMRZUTHX-QDMNYOKKSA-N |
| XLogP | 8.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.08 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|