C29H50O5Si — CID 58710978
(2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,4,12,15,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-one (PubChem CID 58710978) has the molecular formula C29H50O5Si and a molecular weight of 506.80 g/mol. Its IUPAC name is (2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,4,12,15,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-one.
| Compound Name | (2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,4,12,15,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-one |
|---|---|
| PubChem CID | 58710978 |
| Molecular Formula | C29H50O5Si |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,4,12,15,16-pentamethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-one |
| SMILES | CC1(C)O[C@@H]2C3C(C(=O)C(C)(O)[C@@]4(C)C3CC[C@@H]4O[Si](C)(C)C(C)(C)C)[C@@]3(C)CCCCC3[C@H]2O1 |
| InChI | InChI=1S/C29H50O5Si/c1-25(2,3)35(9,10)34-19-15-14-17-20-21(24(30)29(8,31)28(17,19)7)27(6)16-12-11-13-18(27)22-23(20)33-26(4,5)32-22/h17-23,31H,11-16H2,1-10H3/t17?,18?,19-,20?,21?,22+,23+,27-,28-,29?/m0/s1 |
| InChIKey | CDZOJPYJKOKITC-OWOKUQRISA-N |
| XLogP | 6.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|