C28H49NO5Si — CID 172961554
(2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-16-[(E)-hydroxyiminomethyl]-4,4,12-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol (PubChem CID 172961554) has the molecular formula C28H49NO5Si and a molecular weight of 507.79 g/mol. Its IUPAC name is (2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-16-[(E)-hydroxyiminomethyl]-4,4,12-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol.
| Compound Name | (2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-16-[(E)-hydroxyiminomethyl]-4,4,12-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol |
|---|---|
| PubChem CID | 172961554 |
| Molecular Formula | C28H49NO5Si |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 507.34 |
| IUPAC Name | (2R,6R,12S,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-16-[(E)-hydroxyiminomethyl]-4,4,12-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol |
| SMILES | CC1(C)O[C@@H]2C3C(C(O)C[C@@]4(/C=N/O)C3CC[C@@H]4O[Si](C)(C)C(C)(C)C)[C@@]3(C)CCCCC3[C@H]2O1 |
| InChI | InChI=1S/C28H49NO5Si/c1-25(2,3)35(7,8)34-20-13-12-17-21-22(19(30)15-28(17,20)16-29-31)27(6)14-10-9-11-18(27)23-24(21)33-26(4,5)32-23/h16-24,30-31H,9-15H2,1-8H3/b29-16+/t17?,18?,19?,20-,21?,22?,23+,24+,27-,28+/m0/s1 |
| InChIKey | RILKBROFWSBYQA-GMXVVCMZSA-N |
| XLogP | 5.96 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|