C27H48O4Si — CID 91426759
(2R,6R,9S,16S,17S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ol (PubChem CID 91426759) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is (2R,6R,9S,16S,17S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ol.
| Compound Name | (2R,6R,9S,16S,17S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ol |
|---|---|
| PubChem CID | 91426759 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (2R,6R,9S,16S,17S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ol |
| SMILES | CC1(C)O[C@@H]2C3C[C@@H](O[Si](C)(C)C(C)(C)C)CCC3C3CC[C@@]4(C)C(CC[C@@H]4O)C3[C@H]2O1 |
| InChI | InChI=1S/C27H48O4Si/c1-25(2,3)32(7,8)31-16-9-10-17-18-13-14-27(6)20(11-12-21(27)28)22(18)24-23(19(17)15-16)29-26(4,5)30-24/h16-24,28H,9-15H2,1-8H3/t16-,17?,18?,19?,20?,21-,22?,23+,24+,27-/m0/s1 |
| InChIKey | QVBNPBMHQLAGFX-BCSNIGTNSA-N |
| XLogP | 6.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|