C14H27IO4Si — CID 10787913
(3aR,4R,5S,6S,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-ol (PubChem CID 10787913) has the molecular formula C14H27IO4Si and a molecular weight of 414.36 g/mol. Its IUPAC name is (3aR,4R,5S,6S,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-ol.
| Compound Name | (3aR,4R,5S,6S,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-ol |
|---|---|
| PubChem CID | 10787913 |
| Molecular Formula | C14H27IO4Si |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (3aR,4R,5S,6S,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-ol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](I)[C@@H]2O1 |
| InChI | InChI=1S/C14H27IO4Si/c1-13(2,3)20(6,7)19-11-9(16)8(15)10-12(11)18-14(4,5)17-10/h8-12,16H,1-7H3/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | RWYIERAVRMKLDY-GCHJQGSQSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|