C17H34O6Si — CID 11089770
(3aR,4S,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol (PubChem CID 11089770) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is (3aR,4S,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aR,4S,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 11089770 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (3aR,4S,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
| SMILES | COCO[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H34O6Si/c1-16(2,3)24(7,8)23-11-9-12(20-10-19-6)14-15(13(11)18)22-17(4,5)21-14/h11-15,18H,9-10H2,1-8H3/t11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | AVTMEYPBIIJAML-SBJFKYEJSA-N |
| XLogP | 2.65 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|