C17H33NO5Si — CID 102427023
methyl 2-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-4-yl]acetate (PubChem CID 102427023) has the molecular formula C17H33NO5Si and a molecular weight of 359.54 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-4-yl]acetate |
|---|---|
| PubChem CID | 102427023 |
| Molecular Formula | C17H33NO5Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl 2-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H33NO5Si/c1-16(2,3)24(7,8)23-12-10-18-11(9-13(19)20-6)14-15(12)22-17(4,5)21-14/h11-12,14-15,18H,9-10H2,1-8H3/t11-,12+,14-,15-/m1/s1 |
| InChIKey | OGLKKQPVKWWIMV-AYRXBEOTSA-N |
| XLogP | 2.43 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|