C17H32N2O5Si — CID 90176398
(Z)-2-[(3aS,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-hydroxyprop-2-enamide (PubChem CID 90176398) has the molecular formula C17H32N2O5Si and a molecular weight of 372.54 g/mol. Its IUPAC name is (Z)-2-[(3aS,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-hydroxyprop-2-enamide.
| Compound Name | (Z)-2-[(3aS,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 90176398 |
| Molecular Formula | C17H32N2O5Si |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (Z)-2-[(3aS,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-hydroxyprop-2-enamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)NC(/C(=C/O)C(N)=O)[C@@H]2O1 |
| InChI | InChI=1S/C17H32N2O5Si/c1-16(2,3)25(6,7)22-9-11-13-14(24-17(4,5)23-13)12(19-11)10(8-20)15(18)21/h8,11-14,19-20H,9H2,1-7H3,(H2,18,21)/b10-8-/t11-,12?,13-,14+/m1/s1 |
| InChIKey | ZWZHTTTYVNWEDF-OPFULBKOSA-N |
| XLogP | 1.80 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|