C15H30O9SSi — CID 174457520
(3aS,4R,6S,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-sulfonic acid (PubChem CID 174457520) has the molecular formula C15H30O9SSi and a molecular weight of 414.55 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-sulfonic acid.
| Compound Name | (3aS,4R,6S,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-sulfonic acid |
|---|---|
| PubChem CID | 174457520 |
| Molecular Formula | C15H30O9SSi |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (3aS,4R,6S,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-sulfonic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](O)[C@@](O)(S(=O)(=O)O)O[C@@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O9SSi/c1-13(2,3)26(6,7)21-8-9-10-11(24-14(4,5)23-10)12(16)15(17,22-9)25(18,19)20/h9-12,16-17H,8H2,1-7H3,(H,18,19,20)/t9-,10+,11+,12-,15+/m1/s1 |
| InChIKey | BJRKJICSVRHIBW-KYSMWIMPSA-N |
| XLogP | 0.82 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|