C15H29IO5Si — CID 23659967
(3aR,4R,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-iodo-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol (PubChem CID 23659967) has the molecular formula C15H29IO5Si and a molecular weight of 444.38 g/mol. Its IUPAC name is (3aR,4R,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-iodo-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol.
| Compound Name | (3aR,4R,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-iodo-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol |
|---|---|
| PubChem CID | 23659967 |
| Molecular Formula | C15H29IO5Si |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (3aR,4R,7R,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-iodo-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@@H]2I |
| InChI | InChI=1S/C15H29IO5Si/c1-14(2,3)22(6,7)18-8-9-11-12(10(16)13(17)19-9)21-15(4,5)20-11/h9-13,17H,8H2,1-7H3/t9-,10-,11-,12+,13?/m1/s1 |
| InChIKey | ZMHQYXZGDWXCMT-PNKOWGENSA-N |
| XLogP | 3.05 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|