C14H28O4Si — CID 22308831
(3aR,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol (PubChem CID 22308831) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (3aR,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 22308831 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3aR,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](C[Si](C)(C)C(C)(C)C)OC(O)[C@@H]2O1 |
| InChI | InChI=1S/C14H28O4Si/c1-13(2,3)19(6,7)8-9-10-11(12(15)16-9)18-14(4,5)17-10/h9-12,15H,8H2,1-7H3/t9-,10+,11+,12?/m0/s1 |
| InChIKey | USCZZTGMOAFZDI-YZTHKRDXSA-N |
| XLogP | 2.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|