C9H16O5 — CID 70964585
(4R,6R)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol (PubChem CID 70964585) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (4R,6R)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (4R,6R)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 70964585 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (4R,6R)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| SMILES | COC[C@H]1O[C@@H](O)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C9H16O5/c1-9(2)13-6-5(4-11-3)12-8(10)7(6)14-9/h5-8,10H,4H2,1-3H3/t5-,6?,7?,8-/m1/s1 |
| InChIKey | XANYAUZJWXGIGN-LFHVAVFRSA-N |
| XLogP | -0.13 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |