About 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol
2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol (PubChem CID 155407448) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol |
| PubChem CID | 155407448 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol |
| SMILES | COCC1OC(C)(C)OC1C1CCC1O |
| InChI | InChI=1S/C11H20O4/c1-11(2)14-9(6-13-3)10(15-11)7-4-5-8(7)12/h7-10,12H,4-6H2,1-3H3 |
| InChIKey | CFKNMYXLQPNJNM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol?
The IUPAC name of 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol (CID 155407448) is 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol.
What is the SMILES notation for 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol?
The canonical SMILES for 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol is COCC1OC(C)(C)OC1C1CCC1O.
What is the InChIKey of 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol?
The InChIKey is CFKNMYXLQPNJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-11(2)14-9(6-13-3)10(15-11)7-4-5-8(7)12/h7-10,12H,4-6H2,1-3H3.
What are the key properties of 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol?
2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol has a molecular weight of 216.28 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(methoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclobutan-1-ol is sourced from PubChem (CID 155407448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).