C9H16O4 — CID 102460863
(3aS,4R,5S,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol (PubChem CID 102460863) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol.
| Compound Name | (3aS,4R,5S,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol |
|---|---|
| PubChem CID | 102460863 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3aS,4R,5S,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](O)CC[C@H]2O1 |
| InChI | InChI=1S/C9H16O4/c1-9(2)12-6-4-3-5(10)7(11)8(6)13-9/h5-8,10-11H,3-4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | JABCAVZMRFOYMB-LXGUWJNJSA-N |
| XLogP | 0.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |