C9H16O4S — CID 10878680
(3aS,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol (PubChem CID 10878680) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is (3aS,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol.
| Compound Name | (3aS,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol |
|---|---|
| PubChem CID | 10878680 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (3aS,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol |
| SMILES | CO[C@@H]1SC[C@H]2OC(C)(C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C9H16O4S/c1-9(2)12-5-4-14-8(11-3)6(10)7(5)13-9/h5-8,10H,4H2,1-3H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | QEBMPYJOYIXGGG-ULAWRXDQSA-N |
| XLogP | 0.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |