C10H18O6S2 — CID 101384983
[(3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl] methanesulfonate (PubChem CID 101384983) has the molecular formula C10H18O6S2 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl] methanesulfonate.
| Compound Name | [(3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 101384983 |
| Molecular Formula | C10H18O6S2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [(3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl] methanesulfonate |
| SMILES | CO[C@H]1SC[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C10H18O6S2/c1-10(2)14-6-5-17-9(13-3)8(7(6)15-10)16-18(4,11)12/h6-9H,5H2,1-4H3/t6-,7-,8+,9-/m0/s1 |
| InChIKey | CBOBNIHVGJCIFQ-MAUMQABQSA-N |
| XLogP | 0.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|