C8H12O3S — CID 130230960
(3aS,4R)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carbaldehyde (PubChem CID 130230960) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is (3aS,4R)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carbaldehyde.
| Compound Name | (3aS,4R)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 130230960 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (3aS,4R)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carbaldehyde |
| SMILES | CC1(C)OC2CS[C@@H](C=O)[C@H]2O1 |
| InChI | InChI=1S/C8H12O3S/c1-8(2)10-5-4-12-6(3-9)7(5)11-8/h3,5-7H,4H2,1-2H3/t5?,6-,7-/m0/s1 |
| InChIKey | PLJDPCKBUDCRQP-BYRXKDITSA-N |
| XLogP | 0.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|