C5H8O3 — CID 23218533
4,4-dimethyl-1,3-dioxetane-2-carbaldehyde (PubChem CID 23218533) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is 4,4-dimethyl-1,3-dioxetane-2-carbaldehyde.
| Compound Name | 4,4-dimethyl-1,3-dioxetane-2-carbaldehyde |
|---|---|
| PubChem CID | 23218533 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 4,4-dimethyl-1,3-dioxetane-2-carbaldehyde |
| SMILES | CC1(C)OC(C=O)O1 |
| InChI | InChI=1S/C5H8O3/c1-5(2)7-4(3-6)8-5/h3-4H,1-2H3 |
| InChIKey | ZFUFMJJMSNUCOI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|