C6H6O6 — CID 54209022
1,3,5-trioxane-2,4,6-tricarbaldehyde (PubChem CID 54209022) has the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. Its IUPAC name is 1,3,5-trioxane-2,4,6-tricarbaldehyde.
| Compound Name | 1,3,5-trioxane-2,4,6-tricarbaldehyde |
|---|---|
| PubChem CID | 54209022 |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 1,3,5-trioxane-2,4,6-tricarbaldehyde |
| SMILES | O=CC1OC(C=O)OC(C=O)O1 |
| InChI | InChI=1S/C6H6O6/c7-1-4-10-5(2-8)12-6(3-9)11-4/h1-6H |
| InChIKey | PUPNDFQMYHQPRQ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|