C8H8O3 — CID 130682244
(2R,7S)-2,7-dihydrooxepine-2,7-dicarbaldehyde (PubChem CID 130682244) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is (2R,7S)-2,7-dihydrooxepine-2,7-dicarbaldehyde.
| Compound Name | (2R,7S)-2,7-dihydrooxepine-2,7-dicarbaldehyde |
|---|---|
| PubChem CID | 130682244 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (2R,7S)-2,7-dihydrooxepine-2,7-dicarbaldehyde |
| SMILES | O=C[C@@H]1C=CC=C[C@H](C=O)O1 |
| InChI | InChI=1S/C8H8O3/c9-5-7-3-1-2-4-8(6-10)11-7/h1-8H/t7-,8+ |
| InChIKey | HEYOVGGFJCOWAQ-OCAPTIKFSA-N |
| XLogP | 0.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|