C10H12O2 — CID 142179134
2-cyclohepta-2,4,6-trien-1-yl-3-hydroxypropanal (PubChem CID 142179134) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-cyclohepta-2,4,6-trien-1-yl-3-hydroxypropanal.
| Compound Name | 2-cyclohepta-2,4,6-trien-1-yl-3-hydroxypropanal |
|---|---|
| PubChem CID | 142179134 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-cyclohepta-2,4,6-trien-1-yl-3-hydroxypropanal |
| SMILES | O=CC(CO)C1C=CC=CC=C1 |
| InChI | InChI=1S/C10H12O2/c11-7-10(8-12)9-5-3-1-2-4-6-9/h1-7,9-10,12H,8H2 |
| InChIKey | WYNDZBJSHMASHZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|