C12H14OZr — CID 154416903
2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium (PubChem CID 154416903) has the molecular formula C12H14OZr and a molecular weight of 265.47 g/mol. Its IUPAC name is 2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium.
| Compound Name | 2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium |
|---|---|
| PubChem CID | 154416903 |
| Molecular Formula | C12H14OZr |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium |
| SMILES | OCC(C1C=CC=C1)C1C=CC=C1.[Zr] |
| InChI | InChI=1S/C12H14O.Zr/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11;/h1-8,10-13H,9H2; |
| InChIKey | GBLUXMRTTOFBGZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |