C9H12O2 — CID 140982379
6-(1-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-one (PubChem CID 140982379) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 6-(1-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-(1-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 140982379 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 6-(1-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(CO)C1C=CC=CC1=O |
| InChI | InChI=1S/C9H12O2/c1-7(6-10)8-4-2-3-5-9(8)11/h2-5,7-8,10H,6H2,1H3 |
| InChIKey | ZJUMYCSGWPDLGZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |