C10H13NO2 — CID 140991636
6-[2-(dimethylamino)acetyl]cyclohexa-2,4-dien-1-one (PubChem CID 140991636) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-[2-(dimethylamino)acetyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 6-[2-(dimethylamino)acetyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 140991636 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 6-[2-(dimethylamino)acetyl]cyclohexa-2,4-dien-1-one |
| SMILES | CN(C)CC(=O)C1C=CC=CC1=O |
| InChI | InChI=1S/C10H13NO2/c1-11(2)7-10(13)8-5-3-4-6-9(8)12/h3-6,8H,7H2,1-2H3 |
| InChIKey | QIYPOUGMVVUVCU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|