C21H33NO3 — CID 140997111
N-[6-oxo-6-(6-oxocyclohexa-2,4-dien-1-yl)hexyl]nonanamide (PubChem CID 140997111) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[6-oxo-6-(6-oxocyclohexa-2,4-dien-1-yl)hexyl]nonanamide.
| Compound Name | N-[6-oxo-6-(6-oxocyclohexa-2,4-dien-1-yl)hexyl]nonanamide |
|---|---|
| PubChem CID | 140997111 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | N-[6-oxo-6-(6-oxocyclohexa-2,4-dien-1-yl)hexyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCCCCCC(=O)C1C=CC=CC1=O |
| InChI | InChI=1S/C21H33NO3/c1-2-3-4-5-6-9-16-21(25)22-17-12-7-8-14-19(23)18-13-10-11-15-20(18)24/h10-11,13,15,18H,2-9,12,14,16-17H2,1H3,(H,22,25) |
| InChIKey | QTRHOMAWJLPWEI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|