C7H9NO2 — CID 124639297
(6R)-6-[(S)-amino(hydroxy)methyl]cyclohexa-2,4-dien-1-one (PubChem CID 124639297) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (6R)-6-[(S)-amino(hydroxy)methyl]cyclohexa-2,4-dien-1-one.
| Compound Name | (6R)-6-[(S)-amino(hydroxy)methyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 124639297 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (6R)-6-[(S)-amino(hydroxy)methyl]cyclohexa-2,4-dien-1-one |
| SMILES | N[C@@H](O)[C@H]1C=CC=CC1=O |
| InChI | InChI=1S/C7H9NO2/c8-7(10)5-3-1-2-4-6(5)9/h1-5,7,10H,8H2/t5-,7-/m0/s1 |
| InChIKey | NBLHQNQVZDNSRM-FSPLSTOPSA-N |
| XLogP | -0.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|