C8H9NO3 — CID 154344498
2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 154344498) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid.
| Compound Name | 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 154344498 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | [H]/N=C1\C=CC=CC1C(O)C(=O)O |
| InChI | InChI=1S/C8H9NO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-5,7,9-10H,(H,11,12)/b9-6+ |
| InChIKey | RURFJRBROFIHNN-RMKNXTFCSA-N |
| XLogP | 0.19 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|