2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid

C8H9NO3 — CID 154344498

IUPAC2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid
SMILES[H]/N=C1\C=CC=CC1C(O)C(=O)O
InChIInChI=1S/C8H9NO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-5,7,9-10H,(H,11,12)/b9-6+
InChIKeyRURFJRBROFIHNN-RMKNXTFCSA-N
MW167.16 g/mol
LogP0.19
Rot. Bonds2

About 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid

2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 154344498) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid.

Molecular Properties

Compound Name2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid
PubChem CID154344498
Molecular FormulaC8H9NO3
Molecular Weight167.16 g/mol
Exact Mass167.06
IUPAC Name2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid
SMILES[H]/N=C1\C=CC=CC1C(O)C(=O)O
InChIInChI=1S/C8H9NO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-5,7,9-10H,(H,11,12)/b9-6+
InChIKeyRURFJRBROFIHNN-RMKNXTFCSA-N
XLogP0.19
TPSA81.38 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.16
LogP ≤ 50.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid (CID 154344498) is 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid is [H]/N=C1\C=CC=CC1C(O)C(=O)O.
What is the InChIKey of 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is RURFJRBROFIHNN-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H9NO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-5,7,9-10H,(H,11,12)/b9-6+.
What are the key properties of 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid?
2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 167.16 g/mol, XLogP of 0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(6-iminocyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 154344498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).