C15H19NO5 — CID 139662456
3-imino-2-[(6E)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclohexa-2,4-dien-1-yl]oxypropanoic acid (PubChem CID 139662456) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-imino-2-[(6E)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclohexa-2,4-dien-1-yl]oxypropanoic acid.
| Compound Name | 3-imino-2-[(6E)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclohexa-2,4-dien-1-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 139662456 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-imino-2-[(6E)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclohexa-2,4-dien-1-yl]oxypropanoic acid |
| SMILES | [H]/N=C/C(OC1C=CC=C/C1=C\C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H19NO5/c1-15(2,3)21-13(17)8-10-6-4-5-7-11(10)20-12(9-16)14(18)19/h4-9,11-12,16H,1-3H3,(H,18,19)/b10-8+,16-9+ |
| InChIKey | CNLXSUDIEZOTQW-VYWHLGQJSA-N |
| XLogP | 1.87 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|