About 6-oxocyclohexa-2,4-diene-1-carboxylic acid
6-oxocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 53400811) has the molecular formula C7H6O3
and a molecular weight of 138.12 g/mol. Its IUPAC name is 6-oxocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-oxocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 53400811 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 6-oxocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC=CC1=O |
| InChI | InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-5H,(H,9,10) |
| InChIKey | HNNSIJBHYRILKJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-oxocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-oxocyclohexa-2,4-diene-1-carboxylic acid (CID 53400811) is 6-oxocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-oxocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-oxocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=CC=CC1=O.
What is the InChIKey of 6-oxocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is HNNSIJBHYRILKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-5H,(H,9,10).
What are the key properties of 6-oxocyclohexa-2,4-diene-1-carboxylic acid?
6-oxocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 138.12 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 53400811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).