About 10aH-heptalen-1-one
10aH-heptalen-1-one (PubChem CID 91586350) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is 10aH-heptalen-1-one.
Molecular Properties
| Compound Name | 10aH-heptalen-1-one |
| PubChem CID | 91586350 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 10aH-heptalen-1-one |
| SMILES | O=C1C=CC=CC2=CC=CC=CC12 |
| InChI | InChI=1S/C12H10O/c13-12-9-5-4-7-10-6-2-1-3-8-11(10)12/h1-9,11H |
| InChIKey | MXKPLBKFHNVVCO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10aH-heptalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-heptalen-1-one?
The IUPAC name of 10aH-heptalen-1-one (CID 91586350) is 10aH-heptalen-1-one.
What is the SMILES notation for 10aH-heptalen-1-one?
The canonical SMILES for 10aH-heptalen-1-one is O=C1C=CC=CC2=CC=CC=CC12.
What is the InChIKey of 10aH-heptalen-1-one?
The InChIKey is MXKPLBKFHNVVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c13-12-9-5-4-7-10-6-2-1-3-8-11(10)12/h1-9,11H.
What are the key properties of 10aH-heptalen-1-one?
10aH-heptalen-1-one has a molecular weight of 170.21 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-heptalen-1-one is sourced from PubChem (CID 91586350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).