About 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one
6-(4-bromophenyl)cyclohexa-2,4-dien-1-one (PubChem CID 141208013) has the molecular formula C12H9BrO
and a molecular weight of 249.11 g/mol. Its IUPAC name is 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 141208013 |
| Molecular Formula | C12H9BrO |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H9BrO/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h1-8,11H |
| InChIKey | XFFDDPYOSDFVBY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one (CID 141208013) is 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one is O=C1C=CC=CC1c1ccc(Br)cc1.
What is the InChIKey of 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one?
The InChIKey is XFFDDPYOSDFVBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrO/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h1-8,11H.
What are the key properties of 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one?
6-(4-bromophenyl)cyclohexa-2,4-dien-1-one has a molecular weight of 249.11 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromophenyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 141208013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).