C13H12O — CID 14833665
6-benzylcyclohexa-2,4-dien-1-one (PubChem CID 14833665) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is 6-benzylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-benzylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 14833665 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 6-benzylcyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1Cc1ccccc1 |
| InChI | InChI=1S/C13H12O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,12H,10H2 |
| InChIKey | RLVUACSSHRFWSU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |