C14H20 — CID 90929124
(2,3,4-trimethylcyclobutyl)methylbenzene (PubChem CID 90929124) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (2,3,4-trimethylcyclobutyl)methylbenzene.
| Compound Name | (2,3,4-trimethylcyclobutyl)methylbenzene |
|---|---|
| PubChem CID | 90929124 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (2,3,4-trimethylcyclobutyl)methylbenzene |
| SMILES | CC1C(C)C(Cc2ccccc2)C1C |
| InChI | InChI=1S/C14H20/c1-10-11(2)14(12(10)3)9-13-7-5-4-6-8-13/h4-8,10-12,14H,9H2,1-3H3 |
| InChIKey | NJQSQDIYCAUNTD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |