About (2S)-2-benzyl-2H-azirine
(2S)-2-benzyl-2H-azirine (PubChem CID 155642978) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is (2S)-2-benzyl-2H-azirine.
Molecular Properties
| Compound Name | (2S)-2-benzyl-2H-azirine |
| PubChem CID | 155642978 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (2S)-2-benzyl-2H-azirine |
| SMILES | C1=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C9H9N/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,7,9H,6H2/t9-/m0/s1 |
| InChIKey | RQHGSQNYWKLUHE-VIFPVBQESA-N |
| XLogP | 1.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-benzyl-2H-azirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzyl-2H-azirine?
The IUPAC name of (2S)-2-benzyl-2H-azirine (CID 155642978) is (2S)-2-benzyl-2H-azirine.
What is the SMILES notation for (2S)-2-benzyl-2H-azirine?
The canonical SMILES for (2S)-2-benzyl-2H-azirine is C1=N[C@H]1Cc1ccccc1.
What is the InChIKey of (2S)-2-benzyl-2H-azirine?
The InChIKey is RQHGSQNYWKLUHE-VIFPVBQESA-N. The full InChI is InChI=1S/C9H9N/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,7,9H,6H2/t9-/m0/s1.
What are the key properties of (2S)-2-benzyl-2H-azirine?
(2S)-2-benzyl-2H-azirine has a molecular weight of 131.18 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzyl-2H-azirine is sourced from PubChem (CID 155642978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).