About benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine
benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine (PubChem CID 143615009) has the molecular formula C22H20N4
and a molecular weight of 340.43 g/mol. Its IUPAC name is benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine.
Molecular Properties
| Compound Name | benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine |
| PubChem CID | 143615009 |
| Molecular Formula | C22H20N4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine |
| SMILES | c1ccc(Cc2ccccc2)cc1.c1cnc(Cc2ncccn2)nc1 |
| InChI | InChI=1S/C13H12.C9H8N4/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-10-8(11-4-1)7-9-12-5-2-6-13-9/h1-10H,11H2;1-6H,7H2 |
| InChIKey | QRFFDCVTYKJWGC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine?
The IUPAC name of benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine (CID 143615009) is benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine.
What is the SMILES notation for benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine?
The canonical SMILES for benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine is c1ccc(Cc2ccccc2)cc1.c1cnc(Cc2ncccn2)nc1.
What is the InChIKey of benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine?
The InChIKey is QRFFDCVTYKJWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C9H8N4/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-10-8(11-4-1)7-9-12-5-2-6-13-9/h1-10H,11H2;1-6H,7H2.
What are the key properties of benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine?
benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine has a molecular weight of 340.43 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;2-(pyrimidin-2-ylmethyl)pyrimidine is sourced from PubChem (CID 143615009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).