C8H7N5 — CID 67979654
2-(pyrimidin-2-ylmethyl)-1,3,5-triazine (PubChem CID 67979654) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 2-(pyrimidin-2-ylmethyl)-1,3,5-triazine.
| Compound Name | 2-(pyrimidin-2-ylmethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 67979654 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-(pyrimidin-2-ylmethyl)-1,3,5-triazine |
| SMILES | c1cnc(Cc2ncncn2)nc1 |
| InChI | InChI=1S/C8H7N5/c1-2-10-7(11-3-1)4-8-12-5-9-6-13-8/h1-3,5-6H,4H2 |
| InChIKey | PQZHGSGAOTUNFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |