C6H10N4 — CID 70362095
1-(1,3,5-triazin-2-yl)propan-2-amine (PubChem CID 70362095) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(1,3,5-triazin-2-yl)propan-2-amine.
| Compound Name | 1-(1,3,5-triazin-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 70362095 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-(1,3,5-triazin-2-yl)propan-2-amine |
| SMILES | CC(N)Cc1ncncn1 |
| InChI | InChI=1S/C6H10N4/c1-5(7)2-6-9-3-8-4-10-6/h3-5H,2,7H2,1H3 |
| InChIKey | QTSQYEFOZCBKNQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |