C10H17N3O2 — CID 105465048
1-(4,6-dimethoxy-5-methylpyrimidin-2-yl)propan-2-amine (PubChem CID 105465048) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-5-methylpyrimidin-2-yl)propan-2-amine.
| Compound Name | 1-(4,6-dimethoxy-5-methylpyrimidin-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 105465048 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 1-(4,6-dimethoxy-5-methylpyrimidin-2-yl)propan-2-amine |
| SMILES | COc1nc(CC(C)N)nc(OC)c1C |
| InChI | InChI=1S/C10H17N3O2/c1-6(11)5-8-12-9(14-3)7(2)10(13-8)15-4/h6H,5,11H2,1-4H3 |
| InChIKey | GFWICRCXVJUTCQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |