About 2-benzylpyrimidine
2-benzylpyrimidine (PubChem CID 13143744) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-benzylpyrimidine.
Molecular Properties
| Compound Name | 2-benzylpyrimidine |
| PubChem CID | 13143744 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-benzylpyrimidine |
| SMILES | c1ccc(Cc2ncccn2)cc1 |
| InChI | InChI=1S/C11H10N2/c1-2-5-10(6-3-1)9-11-12-7-4-8-13-11/h1-8H,9H2 |
| InChIKey | OOLOAWZLPBDRJQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpyrimidine?
The IUPAC name of 2-benzylpyrimidine (CID 13143744) is 2-benzylpyrimidine.
What is the SMILES notation for 2-benzylpyrimidine?
The canonical SMILES for 2-benzylpyrimidine is c1ccc(Cc2ncccn2)cc1.
What is the InChIKey of 2-benzylpyrimidine?
The InChIKey is OOLOAWZLPBDRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-5-10(6-3-1)9-11-12-7-4-8-13-11/h1-8H,9H2.
What are the key properties of 2-benzylpyrimidine?
2-benzylpyrimidine has a molecular weight of 170.21 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpyrimidine is sourced from PubChem (CID 13143744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).