C12H13N3 — CID 118594943
2-benzyl-4,6-dimethyl-1,3,5-triazine (PubChem CID 118594943) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-benzyl-4,6-dimethyl-1,3,5-triazine.
| Compound Name | 2-benzyl-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118594943 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-benzyl-4,6-dimethyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H13N3/c1-9-13-10(2)15-12(14-9)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | BRIHIQZAOGRSEX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |